C17H20F3N3O — CID 133402575
2,2-dimethyl-N-[2-[[7-(trifluoromethyl)quinolin-4-yl]amino]ethyl]propanamide (PubChem CID 133402575) has the molecular formula C17H20F3N3O and a molecular weight of 339.36 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-[[7-(trifluoromethyl)quinolin-4-yl]amino]ethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[2-[[7-(trifluoromethyl)quinolin-4-yl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 133402575 |
| Molecular Formula | C17H20F3N3O |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2,2-dimethyl-N-[2-[[7-(trifluoromethyl)quinolin-4-yl]amino]ethyl]propanamide |
| SMILES | CC(C)(C)C(=O)NCCNc1ccnc2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C17H20F3N3O/c1-16(2,3)15(24)23-9-8-22-13-6-7-21-14-10-11(17(18,19)20)4-5-12(13)14/h4-7,10H,8-9H2,1-3H3,(H,21,22)(H,23,24) |
| InChIKey | ZJEZCZUTGVJSML-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|