C16H20BrN3O — CID 133326780
N-[2-[(6-bromoquinolin-4-yl)amino]ethyl]-2,2-dimethylpropanamide (PubChem CID 133326780) has the molecular formula C16H20BrN3O and a molecular weight of 350.26 g/mol. Its IUPAC name is N-[2-[(6-bromoquinolin-4-yl)amino]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[(6-bromoquinolin-4-yl)amino]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 133326780 |
| Molecular Formula | C16H20BrN3O |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | N-[2-[(6-bromoquinolin-4-yl)amino]ethyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCCNc1ccnc2ccc(Br)cc12 |
| InChI | InChI=1S/C16H20BrN3O/c1-16(2,3)15(21)20-9-8-19-14-6-7-18-13-5-4-11(17)10-12(13)14/h4-7,10H,8-9H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | JCFGWXNIESSKOQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|