C18H15BrF3N3 — CID 154558825
N-(6-bromoquinolin-4-yl)-N'-[3-(trifluoromethyl)phenyl]ethane-1,2-diamine (PubChem CID 154558825) has the molecular formula C18H15BrF3N3 and a molecular weight of 410.24 g/mol. Its IUPAC name is N-(6-bromoquinolin-4-yl)-N'-[3-(trifluoromethyl)phenyl]ethane-1,2-diamine.
| Compound Name | N-(6-bromoquinolin-4-yl)-N'-[3-(trifluoromethyl)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 154558825 |
| Molecular Formula | C18H15BrF3N3 |
| Molecular Weight | 410.24 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | N-(6-bromoquinolin-4-yl)-N'-[3-(trifluoromethyl)phenyl]ethane-1,2-diamine |
| SMILES | FC(F)(F)c1cccc(NCCNc2ccnc3ccc(Br)cc23)c1 |
| InChI | InChI=1S/C18H15BrF3N3/c19-13-4-5-16-15(11-13)17(6-7-24-16)25-9-8-23-14-3-1-2-12(10-14)18(20,21)22/h1-7,10-11,23H,8-9H2,(H,24,25) |
| InChIKey | HVBDQNMLKOXYLM-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.24 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|