C20H19F3N2O2 — CID 50877956
6,7-diethoxy-N-[3-(trifluoromethyl)phenyl]quinolin-4-amine (PubChem CID 50877956) has the molecular formula C20H19F3N2O2 and a molecular weight of 376.38 g/mol. Its IUPAC name is 6,7-diethoxy-N-[3-(trifluoromethyl)phenyl]quinolin-4-amine.
| Compound Name | 6,7-diethoxy-N-[3-(trifluoromethyl)phenyl]quinolin-4-amine |
|---|---|
| PubChem CID | 50877956 |
| Molecular Formula | C20H19F3N2O2 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 6,7-diethoxy-N-[3-(trifluoromethyl)phenyl]quinolin-4-amine |
| SMILES | CCOc1cc2nccc(Nc3cccc(C(F)(F)F)c3)c2cc1OCC |
| InChI | InChI=1S/C20H19F3N2O2/c1-3-26-18-11-15-16(8-9-24-17(15)12-19(18)27-4-2)25-14-7-5-6-13(10-14)20(21,22)23/h5-12H,3-4H2,1-2H3,(H,24,25) |
| InChIKey | CXGBGXYCAUBVAD-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |