C14H18N2O2 — CID 62192228
6,7-diethoxy-N-methylquinolin-4-amine (PubChem CID 62192228) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 6,7-diethoxy-N-methylquinolin-4-amine.
| Compound Name | 6,7-diethoxy-N-methylquinolin-4-amine |
|---|---|
| PubChem CID | 62192228 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 6,7-diethoxy-N-methylquinolin-4-amine |
| SMILES | CCOc1cc2nccc(NC)c2cc1OCC |
| InChI | InChI=1S/C14H18N2O2/c1-4-17-13-8-10-11(15-3)6-7-16-12(10)9-14(13)18-5-2/h6-9H,4-5H2,1-3H3,(H,15,16) |
| InChIKey | OEVNXCOKGPQRRV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |