C19H26N2O3 — CID 133495450
trans-(1S,2S)-2-[(6,7-diethoxyquinolin-4-yl)amino]cyclohexan-1-ol (PubChem CID 133495450) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is trans-(1S,2S)-2-[(6,7-diethoxyquinolin-4-yl)amino]cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-[(6,7-diethoxyquinolin-4-yl)amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 133495450 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | trans-(1S,2S)-2-[(6,7-diethoxyquinolin-4-yl)amino]cyclohexan-1-ol |
| SMILES | CCOc1cc2nccc(N[C@H]3CCCC[C@@H]3O)c2cc1OCC |
| InChI | InChI=1S/C19H26N2O3/c1-3-23-18-11-13-14(21-15-7-5-6-8-17(15)22)9-10-20-16(13)12-19(18)24-4-2/h9-12,15,17,22H,3-8H2,1-2H3,(H,20,21)/t15-,17-/m0/s1 |
| InChIKey | JOCZRWQFNIGZOW-RDJZCZTQSA-N |
| XLogP | 3.75 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |