C21H21N3O5 — CID 5330468
6,7-dimethoxy-4-(3,4,5-trimethoxyanilino)quinoline-3-carbonitrile (PubChem CID 5330468) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is 6,7-dimethoxy-4-(3,4,5-trimethoxyanilino)quinoline-3-carbonitrile.
| Compound Name | 6,7-dimethoxy-4-(3,4,5-trimethoxyanilino)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 5330468 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 6,7-dimethoxy-4-(3,4,5-trimethoxyanilino)quinoline-3-carbonitrile |
| SMILES | COc1cc2ncc(C#N)c(Nc3cc(OC)c(OC)c(OC)c3)c2cc1OC |
| InChI | InChI=1S/C21H21N3O5/c1-25-16-8-14-15(9-17(16)26-2)23-11-12(10-22)20(14)24-13-6-18(27-3)21(29-5)19(7-13)28-4/h6-9,11H,1-5H3,(H,23,24) |
| InChIKey | LNRFTLQUUQAWMM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 94.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |