C12H14N2O2 — CID 62190466
6,7-dimethoxy-N-methylquinolin-4-amine (PubChem CID 62190466) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 6,7-dimethoxy-N-methylquinolin-4-amine.
| Compound Name | 6,7-dimethoxy-N-methylquinolin-4-amine |
|---|---|
| PubChem CID | 62190466 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 6,7-dimethoxy-N-methylquinolin-4-amine |
| SMILES | CNc1ccnc2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C12H14N2O2/c1-13-9-4-5-14-10-7-12(16-3)11(15-2)6-8(9)10/h4-7H,1-3H3,(H,13,14) |
| InChIKey | FFCUGGBJHADQKT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |