C18H27N3O2 — CID 86037171
N-(6,7-dimethoxyquinolin-4-yl)-N',N'-diethylpropane-1,3-diamine (PubChem CID 86037171) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is N-(6,7-dimethoxyquinolin-4-yl)-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-(6,7-dimethoxyquinolin-4-yl)-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 86037171 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | N-(6,7-dimethoxyquinolin-4-yl)-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1ccnc2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C18H27N3O2/c1-5-21(6-2)11-7-9-19-15-8-10-20-16-13-18(23-4)17(22-3)12-14(15)16/h8,10,12-13H,5-7,9,11H2,1-4H3,(H,19,20) |
| InChIKey | LYNCXKVXOQROPE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|