C17H27ClN3O4P — CID 54601191
N-(7-chloroquinolin-4-yl)-N',N'-diethylbutane-1,4-diamine;phosphoric acid (PubChem CID 54601191) has the molecular formula C17H27ClN3O4P and a molecular weight of 403.85 g/mol. Its IUPAC name is N-(7-chloroquinolin-4-yl)-N',N'-diethylbutane-1,4-diamine;phosphoric acid.
| Compound Name | N-(7-chloroquinolin-4-yl)-N',N'-diethylbutane-1,4-diamine;phosphoric acid |
|---|---|
| PubChem CID | 54601191 |
| Molecular Formula | C17H27ClN3O4P |
| Molecular Weight | 403.85 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | N-(7-chloroquinolin-4-yl)-N',N'-diethylbutane-1,4-diamine;phosphoric acid |
| SMILES | CCN(CC)CCCCNc1ccnc2cc(Cl)ccc12.O=P(O)(O)O |
| InChI | InChI=1S/C17H24ClN3.H3O4P/c1-3-21(4-2)12-6-5-10-19-16-9-11-20-17-13-14(18)7-8-15(16)17;1-5(2,3)4/h7-9,11,13H,3-6,10,12H2,1-2H3,(H,19,20);(H3,1,2,3,4) |
| InChIKey | ZXWMRRIBAWHKKX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.85 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|