C21H26ClN3O — CID 11846959
N-(7-chloroquinolin-4-yl)-N'-(furan-2-ylmethyl)-N'-propylbutane-1,4-diamine (PubChem CID 11846959) has the molecular formula C21H26ClN3O and a molecular weight of 371.91 g/mol. Its IUPAC name is N-(7-chloroquinolin-4-yl)-N'-(furan-2-ylmethyl)-N'-propylbutane-1,4-diamine.
| Compound Name | N-(7-chloroquinolin-4-yl)-N'-(furan-2-ylmethyl)-N'-propylbutane-1,4-diamine |
|---|---|
| PubChem CID | 11846959 |
| Molecular Formula | C21H26ClN3O |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | N-(7-chloroquinolin-4-yl)-N'-(furan-2-ylmethyl)-N'-propylbutane-1,4-diamine |
| SMILES | CCCN(CCCCNc1ccnc2cc(Cl)ccc12)Cc1ccco1 |
| InChI | InChI=1S/C21H26ClN3O/c1-2-12-25(16-18-6-5-14-26-18)13-4-3-10-23-20-9-11-24-21-15-17(22)7-8-19(20)21/h5-9,11,14-15H,2-4,10,12-13,16H2,1H3,(H,23,24) |
| InChIKey | PMPZTWLXIDYKFN-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|