C28H31ClN4 — CID 58476704
N-(7-chloroquinolin-4-yl)-N'-methyl-N'-[2-(N-phenylanilino)ethyl]butane-1,4-diamine (PubChem CID 58476704) has the molecular formula C28H31ClN4 and a molecular weight of 459.04 g/mol. Its IUPAC name is N-(7-chloroquinolin-4-yl)-N'-methyl-N'-[2-(N-phenylanilino)ethyl]butane-1,4-diamine.
| Compound Name | N-(7-chloroquinolin-4-yl)-N'-methyl-N'-[2-(N-phenylanilino)ethyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 58476704 |
| Molecular Formula | C28H31ClN4 |
| Molecular Weight | 459.04 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | N-(7-chloroquinolin-4-yl)-N'-methyl-N'-[2-(N-phenylanilino)ethyl]butane-1,4-diamine |
| SMILES | CN(CCCCNc1ccnc2cc(Cl)ccc12)CCN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H31ClN4/c1-32(20-21-33(24-10-4-2-5-11-24)25-12-6-3-7-13-25)19-9-8-17-30-27-16-18-31-28-22-23(29)14-15-26(27)28/h2-7,10-16,18,22H,8-9,17,19-21H2,1H3,(H,30,31) |
| InChIKey | NCGQEBLODPFDNB-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.04 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|