C13H15BClN2 — CID 70870191
CID 70870191 (PubChem CID 70870191) has the molecular formula C13H15BClN2 and a molecular weight of 245.54 g/mol.
| Compound Name | CID 70870191 |
|---|---|
| PubChem CID | 70870191 |
| Molecular Formula | C13H15BClN2 |
| Molecular Weight | 245.54 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | — |
| SMILES | C[B]CCCNc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C13H15BClN2/c1-14-6-2-7-16-12-5-8-17-13-9-10(15)3-4-11(12)13/h3-5,8-9H,2,6-7H2,1H3,(H,16,17) |
| InChIKey | ONNAYKCCKHWSDO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|