C21H20ClN5 — CID 155559378
N-(7-chloroquinolin-4-yl)-N'-(1,5-naphthyridin-4-yl)butane-1,4-diamine (PubChem CID 155559378) has the molecular formula C21H20ClN5 and a molecular weight of 377.88 g/mol. Its IUPAC name is N-(7-chloroquinolin-4-yl)-N'-(1,5-naphthyridin-4-yl)butane-1,4-diamine.
| Compound Name | N-(7-chloroquinolin-4-yl)-N'-(1,5-naphthyridin-4-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 155559378 |
| Molecular Formula | C21H20ClN5 |
| Molecular Weight | 377.88 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-(7-chloroquinolin-4-yl)-N'-(1,5-naphthyridin-4-yl)butane-1,4-diamine |
| SMILES | Clc1ccc2c(NCCCCNc3ccnc4cccnc34)ccnc2c1 |
| InChI | InChI=1S/C21H20ClN5/c22-15-5-6-16-17(7-12-26-20(16)14-15)23-9-1-2-10-24-19-8-13-25-18-4-3-11-27-21(18)19/h3-8,11-14H,1-2,9-10H2,(H,23,26)(H,24,25) |
| InChIKey | QBOUPMXRVIIJPY-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.88 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|