C14H18ClN3S — CID 14522863
2-[3-[(7-chloroquinolin-4-yl)amino]propylamino]ethanethiol (PubChem CID 14522863) has the molecular formula C14H18ClN3S and a molecular weight of 295.84 g/mol. Its IUPAC name is 2-[3-[(7-chloroquinolin-4-yl)amino]propylamino]ethanethiol.
| Compound Name | 2-[3-[(7-chloroquinolin-4-yl)amino]propylamino]ethanethiol |
|---|---|
| PubChem CID | 14522863 |
| Molecular Formula | C14H18ClN3S |
| Molecular Weight | 295.84 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-[3-[(7-chloroquinolin-4-yl)amino]propylamino]ethanethiol |
| SMILES | SCCNCCCNc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C14H18ClN3S/c15-11-2-3-12-13(4-7-18-14(12)10-11)17-6-1-5-16-8-9-19/h2-4,7,10,16,19H,1,5-6,8-9H2,(H,17,18) |
| InChIKey | RRDVPZZERLQDDH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.84 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|