C19H19BrClN3O — CID 162444660
4-bromo-3-[[3-[(7-chloroquinolin-4-yl)amino]propylamino]methyl]phenol (PubChem CID 162444660) has the molecular formula C19H19BrClN3O and a molecular weight of 420.74 g/mol. Its IUPAC name is 4-bromo-3-[[3-[(7-chloroquinolin-4-yl)amino]propylamino]methyl]phenol.
| Compound Name | 4-bromo-3-[[3-[(7-chloroquinolin-4-yl)amino]propylamino]methyl]phenol |
|---|---|
| PubChem CID | 162444660 |
| Molecular Formula | C19H19BrClN3O |
| Molecular Weight | 420.74 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | 4-bromo-3-[[3-[(7-chloroquinolin-4-yl)amino]propylamino]methyl]phenol |
| SMILES | Oc1ccc(Br)c(CNCCCNc2ccnc3cc(Cl)ccc23)c1 |
| InChI | InChI=1S/C19H19BrClN3O/c20-17-5-3-15(25)10-13(17)12-22-7-1-8-23-18-6-9-24-19-11-14(21)2-4-16(18)19/h2-6,9-11,22,25H,1,7-8,12H2,(H,23,24) |
| InChIKey | ZISNKAHOGOHAGT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.74 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|