C20H22ClN3O2 — CID 46222242
2-[[3-[(7-chloroquinolin-4-yl)amino]propylamino]methyl]-4-methoxyphenol (PubChem CID 46222242) has the molecular formula C20H22ClN3O2 and a molecular weight of 371.87 g/mol. Its IUPAC name is 2-[[3-[(7-chloroquinolin-4-yl)amino]propylamino]methyl]-4-methoxyphenol.
| Compound Name | 2-[[3-[(7-chloroquinolin-4-yl)amino]propylamino]methyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 46222242 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 2-[[3-[(7-chloroquinolin-4-yl)amino]propylamino]methyl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(CNCCCNc2ccnc3cc(Cl)ccc23)c1 |
| InChI | InChI=1S/C20H22ClN3O2/c1-26-16-4-6-20(25)14(11-16)13-22-8-2-9-23-18-7-10-24-19-12-15(21)3-5-17(18)19/h3-7,10-12,22,25H,2,8-9,13H2,1H3,(H,23,24) |
| InChIKey | BRQWHFHTBFSKAA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|