C20H21ClN4OS — CID 44544468
1-[3-[(7-chloroquinolin-4-yl)amino]propyl]-3-(4-methoxyphenyl)thiourea (PubChem CID 44544468) has the molecular formula C20H21ClN4OS and a molecular weight of 400.94 g/mol. Its IUPAC name is 1-[3-[(7-chloroquinolin-4-yl)amino]propyl]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[3-[(7-chloroquinolin-4-yl)amino]propyl]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 44544468 |
| Molecular Formula | C20H21ClN4OS |
| Molecular Weight | 400.94 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 1-[3-[(7-chloroquinolin-4-yl)amino]propyl]-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)NCCCNc2ccnc3cc(Cl)ccc23)cc1 |
| InChI | InChI=1S/C20H21ClN4OS/c1-26-16-6-4-15(5-7-16)25-20(27)24-11-2-10-22-18-9-12-23-19-13-14(21)3-8-17(18)19/h3-9,12-13H,2,10-11H2,1H3,(H,22,23)(H2,24,25,27) |
| InChIKey | AUKRPVQDZHJUGQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 58.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.94 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|