C24H26ClN3O2 — CID 71520943
(E)-N-[5-[(7-chloroquinolin-4-yl)amino]pentyl]-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 71520943) has the molecular formula C24H26ClN3O2 and a molecular weight of 423.94 g/mol. Its IUPAC name is (E)-N-[5-[(7-chloroquinolin-4-yl)amino]pentyl]-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[5-[(7-chloroquinolin-4-yl)amino]pentyl]-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 71520943 |
| Molecular Formula | C24H26ClN3O2 |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | (E)-N-[5-[(7-chloroquinolin-4-yl)amino]pentyl]-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NCCCCCNc2ccnc3cc(Cl)ccc23)cc1 |
| InChI | InChI=1S/C24H26ClN3O2/c1-30-20-9-5-18(6-10-20)7-12-24(29)28-15-4-2-3-14-26-22-13-16-27-23-17-19(25)8-11-21(22)23/h5-13,16-17H,2-4,14-15H2,1H3,(H,26,27)(H,28,29)/b12-7+ |
| InChIKey | AHHNJTADNKMZIX-KPKJPENVSA-N |
| XLogP | 5.31 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|