C21H30ClN3O — CID 42705893
N-[6-[(7-chloroquinolin-4-yl)amino]hexyl]hexanamide (PubChem CID 42705893) has the molecular formula C21H30ClN3O and a molecular weight of 375.94 g/mol. Its IUPAC name is N-[6-[(7-chloroquinolin-4-yl)amino]hexyl]hexanamide.
| Compound Name | N-[6-[(7-chloroquinolin-4-yl)amino]hexyl]hexanamide |
|---|---|
| PubChem CID | 42705893 |
| Molecular Formula | C21H30ClN3O |
| Molecular Weight | 375.94 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | N-[6-[(7-chloroquinolin-4-yl)amino]hexyl]hexanamide |
| SMILES | CCCCCC(=O)NCCCCCCNc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C21H30ClN3O/c1-2-3-6-9-21(26)25-14-8-5-4-7-13-23-19-12-15-24-20-16-17(22)10-11-18(19)20/h10-12,15-16H,2-9,13-14H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | QBCXRCPPWJTZPV-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.94 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|