C15H19Cl2N3O — CID 12742474
N-butyl-2-[(7-chloroquinolin-4-yl)amino]acetamide;hydrochloride (PubChem CID 12742474) has the molecular formula C15H19Cl2N3O and a molecular weight of 328.24 g/mol. Its IUPAC name is N-butyl-2-[(7-chloroquinolin-4-yl)amino]acetamide;hydrochloride.
| Compound Name | N-butyl-2-[(7-chloroquinolin-4-yl)amino]acetamide;hydrochloride |
|---|---|
| PubChem CID | 12742474 |
| Molecular Formula | C15H19Cl2N3O |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | N-butyl-2-[(7-chloroquinolin-4-yl)amino]acetamide;hydrochloride |
| SMILES | CCCCNC(=O)CNc1ccnc2cc(Cl)ccc12.Cl |
| InChI | InChI=1S/C15H18ClN3O.ClH/c1-2-3-7-18-15(20)10-19-13-6-8-17-14-9-11(16)4-5-12(13)14;/h4-6,8-9H,2-3,7,10H2,1H3,(H,17,19)(H,18,20);1H |
| InChIKey | TZHMZMITRSXWDQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|