C16H20ClN3O2 — CID 46781267
N-[4-[(7-chloroquinolin-4-yl)amino]pentyl]-2-hydroxyacetamide (PubChem CID 46781267) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is N-[4-[(7-chloroquinolin-4-yl)amino]pentyl]-2-hydroxyacetamide.
| Compound Name | N-[4-[(7-chloroquinolin-4-yl)amino]pentyl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 46781267 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | N-[4-[(7-chloroquinolin-4-yl)amino]pentyl]-2-hydroxyacetamide |
| SMILES | CC(CCCNC(=O)CO)Nc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C16H20ClN3O2/c1-11(3-2-7-19-16(22)10-21)20-14-6-8-18-15-9-12(17)4-5-13(14)15/h4-6,8-9,11,21H,2-3,7,10H2,1H3,(H,18,20)(H,19,22) |
| InChIKey | MJFOIOWFYPCSSQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|