C22H32ClN3O4 — CID 69171566
butanedioic acid;4-N-(7-chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine (PubChem CID 69171566) has the molecular formula C22H32ClN3O4 and a molecular weight of 437.97 g/mol. Its IUPAC name is butanedioic acid;4-N-(7-chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine.
| Compound Name | butanedioic acid;4-N-(7-chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine |
|---|---|
| PubChem CID | 69171566 |
| Molecular Formula | C22H32ClN3O4 |
| Molecular Weight | 437.97 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | butanedioic acid;4-N-(7-chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine |
| SMILES | CCN(CC)CCCC(C)Nc1ccnc2cc(Cl)ccc12.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C18H26ClN3.C4H6O4/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18;5-3(6)1-2-4(7)8/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,21);1-2H2,(H,5,6)(H,7,8) |
| InChIKey | PGOVVOUAACXZJV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.97 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |