C20H31N3 — CID 170239569
1-N,1-N-diethyl-4-N-(7-ethylquinolin-4-yl)pentane-1,4-diamine (PubChem CID 170239569) has the molecular formula C20H31N3 and a molecular weight of 313.49 g/mol. Its IUPAC name is 1-N,1-N-diethyl-4-N-(7-ethylquinolin-4-yl)pentane-1,4-diamine.
| Compound Name | 1-N,1-N-diethyl-4-N-(7-ethylquinolin-4-yl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 170239569 |
| Molecular Formula | C20H31N3 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | 1-N,1-N-diethyl-4-N-(7-ethylquinolin-4-yl)pentane-1,4-diamine |
| SMILES | CCc1ccc2c(NC(C)CCCN(CC)CC)ccnc2c1 |
| InChI | InChI=1S/C20H31N3/c1-5-17-10-11-18-19(12-13-21-20(18)15-17)22-16(4)9-8-14-23(6-2)7-3/h10-13,15-16H,5-9,14H2,1-4H3,(H,21,22) |
| InChIKey | OJKDESQAUQJNCI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |