C18H32BrN3O8P2 — CID 21150567
4-N-(7-bromoquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine;phosphoric acid (PubChem CID 21150567) has the molecular formula C18H32BrN3O8P2 and a molecular weight of 560.32 g/mol. Its IUPAC name is 4-N-(7-bromoquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine;phosphoric acid.
| Compound Name | 4-N-(7-bromoquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine;phosphoric acid |
|---|---|
| PubChem CID | 21150567 |
| Molecular Formula | C18H32BrN3O8P2 |
| Molecular Weight | 560.32 g/mol |
| Exact Mass | 559.08 |
| IUPAC Name | 4-N-(7-bromoquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine;phosphoric acid |
| SMILES | CCN(CC)CCCC(C)Nc1ccnc2cc(Br)ccc12.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C18H26BrN3.2H3O4P/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18;2*1-5(2,3)4/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,21);2*(H3,1,2,3,4) |
| InChIKey | PPIBSOPQSTYDNF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 183.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|