C21H31ClN4O — CID 146188349
4-N-(7-chloroquinolin-4-yl)-1-N-ethyl-1-N-[2-(prop-1-en-2-ylamino)oxyethyl]pentane-1,4-diamine (PubChem CID 146188349) has the molecular formula C21H31ClN4O and a molecular weight of 390.96 g/mol. Its IUPAC name is 4-N-(7-chloroquinolin-4-yl)-1-N-ethyl-1-N-[2-(prop-1-en-2-ylamino)oxyethyl]pentane-1,4-diamine.
| Compound Name | 4-N-(7-chloroquinolin-4-yl)-1-N-ethyl-1-N-[2-(prop-1-en-2-ylamino)oxyethyl]pentane-1,4-diamine |
|---|---|
| PubChem CID | 146188349 |
| Molecular Formula | C21H31ClN4O |
| Molecular Weight | 390.96 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 4-N-(7-chloroquinolin-4-yl)-1-N-ethyl-1-N-[2-(prop-1-en-2-ylamino)oxyethyl]pentane-1,4-diamine |
| SMILES | C=C(C)NOCCN(CC)CCCC(C)Nc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C21H31ClN4O/c1-5-26(13-14-27-25-16(2)3)12-6-7-17(4)24-20-10-11-23-21-15-18(22)8-9-19(20)21/h8-11,15,17,25H,2,5-7,12-14H2,1,3-4H3,(H,23,24) |
| InChIKey | WYJMOGLRWMGSOF-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 49.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.96 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|