C26H39Cl4N4O5P — CID 155670014
methyl (2S)-2-[[2-[[(4R)-4-[(7-chloroquinolin-4-yl)amino]pentyl]-ethylamino]ethoxy-(2,2,2-trichloroethoxy)phosphoryl]amino]-3-methylbutanoate (PubChem CID 155670014) has the molecular formula C26H39Cl4N4O5P and a molecular weight of 660.41 g/mol. Its IUPAC name is methyl (2S)-2-[[2-[[(4R)-4-[(7-chloroquinolin-4-yl)amino]pentyl]-ethylamino]ethoxy-(2,2,2-trichloroethoxy)phosphoryl]amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[[2-[[(4R)-4-[(7-chloroquinolin-4-yl)amino]pentyl]-ethylamino]ethoxy-(2,2,2-trichloroethoxy)phosphoryl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 155670014 |
| Molecular Formula | C26H39Cl4N4O5P |
| Molecular Weight | 660.41 g/mol |
| Exact Mass | 658.14 |
| IUPAC Name | methyl (2S)-2-[[2-[[(4R)-4-[(7-chloroquinolin-4-yl)amino]pentyl]-ethylamino]ethoxy-(2,2,2-trichloroethoxy)phosphoryl]amino]-3-methylbutanoate |
| SMILES | CCN(CCC[C@@H](C)Nc1ccnc2cc(Cl)ccc12)CCOP(=O)(N[C@H](C(=O)OC)C(C)C)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C26H39Cl4N4O5P/c1-6-34(13-7-8-19(4)32-22-11-12-31-23-16-20(27)9-10-21(22)23)14-15-38-40(36,39-17-26(28,29)30)33-24(18(2)3)25(35)37-5/h9-12,16,18-19,24H,6-8,13-15,17H2,1-5H3,(H,31,32)(H,33,36)/t19-,24+,40?/m1/s1 |
| InChIKey | GTDCGAYGBXGECG-SYHSTFOYSA-N |
| XLogP | 7.09 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.41 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|