C30H42ClN4O6P — CID 155670057
2-methoxyethyl (2S)-2-[[2-[[(4R)-4-[(7-chloroquinolin-4-yl)amino]pentyl]-ethylamino]ethoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 155670057) has the molecular formula C30H42ClN4O6P and a molecular weight of 621.12 g/mol. Its IUPAC name is 2-methoxyethyl (2S)-2-[[2-[[(4R)-4-[(7-chloroquinolin-4-yl)amino]pentyl]-ethylamino]ethoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2-methoxyethyl (2S)-2-[[2-[[(4R)-4-[(7-chloroquinolin-4-yl)amino]pentyl]-ethylamino]ethoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 155670057 |
| Molecular Formula | C30H42ClN4O6P |
| Molecular Weight | 621.12 g/mol |
| Exact Mass | 620.25 |
| IUPAC Name | 2-methoxyethyl (2S)-2-[[2-[[(4R)-4-[(7-chloroquinolin-4-yl)amino]pentyl]-ethylamino]ethoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCN(CCC[C@@H](C)Nc1ccnc2cc(Cl)ccc12)CCO[P@@](=O)(N[C@@H](C)C(=O)OCCOC)Oc1ccccc1 |
| InChI | InChI=1S/C30H42ClN4O6P/c1-5-35(17-9-10-23(2)33-28-15-16-32-29-22-25(31)13-14-27(28)29)18-19-40-42(37,41-26-11-7-6-8-12-26)34-24(3)30(36)39-21-20-38-4/h6-8,11-16,22-24H,5,9-10,17-21H2,1-4H3,(H,32,33)(H,34,37)/t23-,24+,42+/m1/s1 |
| InChIKey | CDXSMDXTOYJMRY-VGTTZPSPSA-N |
| XLogP | 6.16 |
| TPSA | 111.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.12 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|