C33H36ClN3O8S — CID 87776022
2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethyl hydrogen sulfate;5,7-dihydroxy-2-phenylchromen-4-one (PubChem CID 87776022) has the molecular formula C33H36ClN3O8S and a molecular weight of 670.18 g/mol. Its IUPAC name is 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethyl hydrogen sulfate;5,7-dihydroxy-2-phenylchromen-4-one.
| Compound Name | 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethyl hydrogen sulfate;5,7-dihydroxy-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 87776022 |
| Molecular Formula | C33H36ClN3O8S |
| Molecular Weight | 670.18 g/mol |
| Exact Mass | 669.19 |
| IUPAC Name | 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethyl hydrogen sulfate;5,7-dihydroxy-2-phenylchromen-4-one |
| SMILES | CCN(CCCC(C)Nc1ccnc2cc(Cl)ccc12)CCOS(=O)(=O)O.O=c1cc(-c2ccccc2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C18H26ClN3O4S.C15H10O4/c1-3-22(11-12-26-27(23,24)25)10-4-5-14(2)21-17-8-9-20-18-13-15(19)6-7-16(17)18;16-10-6-11(17)15-12(18)8-13(19-14(15)7-10)9-4-2-1-3-5-9/h6-9,13-14H,3-5,10-12H2,1-2H3,(H,20,21)(H,23,24,25);1-8,16-17H |
| InChIKey | XAAUQLIVGWGIIH-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 162.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.18 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|