C18H30ClN3O8P2 — CID 134081808
CID 134081808 (PubChem CID 134081808) has the molecular formula C18H30ClN3O8P2 and a molecular weight of 513.85 g/mol.
| Compound Name | CID 134081808 |
|---|---|
| PubChem CID | 134081808 |
| Molecular Formula | C18H30ClN3O8P2 |
| Molecular Weight | 513.85 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | — |
| SMILES | CCN(CC)CCCC(C)Nc1ccnc2cc(Cl)ccc12.O=P(=O)OO.O=P(=O)OO.[H].[H] |
| InChI | InChI=1S/C18H26ClN3.2HO4P.2H/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18;2*1-4-5(2)3;;/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,21);2*1H;; |
| InChIKey | WYRQBMPUEQGYSU-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 155.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.85 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|