C22H29ClF6N3O4P — CID 155670045
2-[[(4R)-4-[(7-chloroquinolin-4-yl)amino]pentyl]-ethylamino]ethyl bis(2,2,2-trifluoroethyl) phosphate (PubChem CID 155670045) has the molecular formula C22H29ClF6N3O4P and a molecular weight of 579.91 g/mol. Its IUPAC name is 2-[[(4R)-4-[(7-chloroquinolin-4-yl)amino]pentyl]-ethylamino]ethyl bis(2,2,2-trifluoroethyl) phosphate.
| Compound Name | 2-[[(4R)-4-[(7-chloroquinolin-4-yl)amino]pentyl]-ethylamino]ethyl bis(2,2,2-trifluoroethyl) phosphate |
|---|---|
| PubChem CID | 155670045 |
| Molecular Formula | C22H29ClF6N3O4P |
| Molecular Weight | 579.91 g/mol |
| Exact Mass | 579.15 |
| IUPAC Name | 2-[[(4R)-4-[(7-chloroquinolin-4-yl)amino]pentyl]-ethylamino]ethyl bis(2,2,2-trifluoroethyl) phosphate |
| SMILES | CCN(CCC[C@@H](C)Nc1ccnc2cc(Cl)ccc12)CCOP(=O)(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C22H29ClF6N3O4P/c1-3-32(11-12-34-37(33,35-14-21(24,25)26)36-15-22(27,28)29)10-4-5-16(2)31-19-8-9-30-20-13-17(23)6-7-18(19)20/h6-9,13,16H,3-5,10-12,14-15H2,1-2H3,(H,30,31)/t16-/m1/s1 |
| InChIKey | BRKDAZLIXYCMOT-MRXNPFEDSA-N |
| XLogP | 7.07 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.91 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|