C21H32ClN3 — CID 178050529
4-N-(7-chloroquinolin-4-yl)-1-N-ethyl-1-N-pentylpentane-1,4-diamine (PubChem CID 178050529) has the molecular formula C21H32ClN3 and a molecular weight of 361.96 g/mol. Its IUPAC name is 4-N-(7-chloroquinolin-4-yl)-1-N-ethyl-1-N-pentylpentane-1,4-diamine.
| Compound Name | 4-N-(7-chloroquinolin-4-yl)-1-N-ethyl-1-N-pentylpentane-1,4-diamine |
|---|---|
| PubChem CID | 178050529 |
| Molecular Formula | C21H32ClN3 |
| Molecular Weight | 361.96 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 4-N-(7-chloroquinolin-4-yl)-1-N-ethyl-1-N-pentylpentane-1,4-diamine |
| SMILES | CCCCCN(CC)CCCC(C)Nc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C21H32ClN3/c1-4-6-7-14-25(5-2)15-8-9-17(3)24-20-12-13-23-21-16-18(22)10-11-19(20)21/h10-13,16-17H,4-9,14-15H2,1-3H3,(H,23,24) |
| InChIKey | RYLUNICFUCORPD-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.96 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|