C30H22O12S — CID 174670813
bis(5,7-dihydroxy-2-phenylchromen-4-one);sulfuric acid (PubChem CID 174670813) has the molecular formula C30H22O12S and a molecular weight of 606.56 g/mol. Its IUPAC name is bis(5,7-dihydroxy-2-phenylchromen-4-one);sulfuric acid.
| Compound Name | bis(5,7-dihydroxy-2-phenylchromen-4-one);sulfuric acid |
|---|---|
| PubChem CID | 174670813 |
| Molecular Formula | C30H22O12S |
| Molecular Weight | 606.56 g/mol |
| Exact Mass | 606.08 |
| IUPAC Name | bis(5,7-dihydroxy-2-phenylchromen-4-one);sulfuric acid |
| SMILES | O=S(=O)(O)O.O=c1cc(-c2ccccc2)oc2cc(O)cc(O)c12.O=c1cc(-c2ccccc2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/2C15H10O4.H2O4S/c2*16-10-6-11(17)15-12(18)8-13(19-14(15)7-10)9-4-2-1-3-5-9;1-5(2,3)4/h2*1-8,16-17H;(H2,1,2,3,4) |
| InChIKey | NFLGYIJYYLGMCC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 215.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.56 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|