C15H11BO6 — CID 71504390
[4-(5,7-dihydroxy-4-oxochromen-2-yl)phenyl]boronic acid (PubChem CID 71504390) has the molecular formula C15H11BO6 and a molecular weight of 298.06 g/mol. Its IUPAC name is [4-(5,7-dihydroxy-4-oxochromen-2-yl)phenyl]boronic acid.
| Compound Name | [4-(5,7-dihydroxy-4-oxochromen-2-yl)phenyl]boronic acid |
|---|---|
| PubChem CID | 71504390 |
| Molecular Formula | C15H11BO6 |
| Molecular Weight | 298.06 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | [4-(5,7-dihydroxy-4-oxochromen-2-yl)phenyl]boronic acid |
| SMILES | O=c1cc(-c2ccc(B(O)O)cc2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C15H11BO6/c17-10-5-11(18)15-12(19)7-13(22-14(15)6-10)8-1-3-9(4-2-8)16(20)21/h1-7,17-18,20-21H |
| InChIKey | XRAAHOYHLDJBQW-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.06 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|