C19H19NO4 — CID 71600014
2-[4-(4-aminobutyl)phenyl]-5,7-dihydroxychromen-4-one (PubChem CID 71600014) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 2-[4-(4-aminobutyl)phenyl]-5,7-dihydroxychromen-4-one.
| Compound Name | 2-[4-(4-aminobutyl)phenyl]-5,7-dihydroxychromen-4-one |
|---|---|
| PubChem CID | 71600014 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2-[4-(4-aminobutyl)phenyl]-5,7-dihydroxychromen-4-one |
| SMILES | NCCCCc1ccc(-c2cc(=O)c3c(O)cc(O)cc3o2)cc1 |
| InChI | InChI=1S/C19H19NO4/c20-8-2-1-3-12-4-6-13(7-5-12)17-11-16(23)19-15(22)9-14(21)10-18(19)24-17/h4-7,9-11,21-22H,1-3,8,20H2 |
| InChIKey | QFCKMTKHECPSPX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|