C17H16O7 — CID 67363741
2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one;methoxymethane (PubChem CID 67363741) has the molecular formula C17H16O7 and a molecular weight of 332.31 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one;methoxymethane.
| Compound Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one;methoxymethane |
|---|---|
| PubChem CID | 67363741 |
| Molecular Formula | C17H16O7 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one;methoxymethane |
| SMILES | COC.O=c1cc(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C15H10O6.C2H6O/c16-8-4-11(19)15-12(20)6-13(21-14(15)5-8)7-1-2-9(17)10(18)3-7;1-3-2/h1-6,16-19H;1-2H3 |
| InChIKey | WTJCXYVJBVOCGX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|