C20H24O4 — CID 90949026
5,7-dihydroxy-2-(4-methylphenyl)chromen-4-one;ethane (PubChem CID 90949026) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is 5,7-dihydroxy-2-(4-methylphenyl)chromen-4-one;ethane.
| Compound Name | 5,7-dihydroxy-2-(4-methylphenyl)chromen-4-one;ethane |
|---|---|
| PubChem CID | 90949026 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 5,7-dihydroxy-2-(4-methylphenyl)chromen-4-one;ethane |
| SMILES | CC.CC.Cc1ccc(-c2cc(=O)c3c(O)cc(O)cc3o2)cc1 |
| InChI | InChI=1S/C16H12O4.2C2H6/c1-9-2-4-10(5-3-9)14-8-13(19)16-12(18)6-11(17)7-15(16)20-14;2*1-2/h2-8,17-18H,1H3;2*1-2H3 |
| InChIKey | BITWZUWPMMNXOK-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |