C20H16O5 — CID 25170320
5,7-dihydroxy-2-[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]chromen-4-one (PubChem CID 25170320) has the molecular formula C20H16O5 and a molecular weight of 336.34 g/mol. Its IUPAC name is 5,7-dihydroxy-2-[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]chromen-4-one.
| Compound Name | 5,7-dihydroxy-2-[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]chromen-4-one |
|---|---|
| PubChem CID | 25170320 |
| Molecular Formula | C20H16O5 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 5,7-dihydroxy-2-[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]chromen-4-one |
| SMILES | CC(C)(O)C#Cc1ccc(-c2cc(=O)c3c(O)cc(O)cc3o2)cc1 |
| InChI | InChI=1S/C20H16O5/c1-20(2,24)8-7-12-3-5-13(6-4-12)17-11-16(23)19-15(22)9-14(21)10-18(19)25-17/h3-6,9-11,21-22,24H,1-2H3 |
| InChIKey | UKTPUSJGZPONIL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|