C23H13NO6 — CID 25170687
5,7-dihydroxy-2-[4-[2-(3-nitrophenyl)ethynyl]phenyl]chromen-4-one (PubChem CID 25170687) has the molecular formula C23H13NO6 and a molecular weight of 399.36 g/mol. Its IUPAC name is 5,7-dihydroxy-2-[4-[2-(3-nitrophenyl)ethynyl]phenyl]chromen-4-one.
| Compound Name | 5,7-dihydroxy-2-[4-[2-(3-nitrophenyl)ethynyl]phenyl]chromen-4-one |
|---|---|
| PubChem CID | 25170687 |
| Molecular Formula | C23H13NO6 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 5,7-dihydroxy-2-[4-[2-(3-nitrophenyl)ethynyl]phenyl]chromen-4-one |
| SMILES | O=c1cc(-c2ccc(C#Cc3cccc([N+](=O)[O-])c3)cc2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C23H13NO6/c25-18-11-19(26)23-20(27)13-21(30-22(23)12-18)16-8-6-14(7-9-16)4-5-15-2-1-3-17(10-15)24(28)29/h1-3,6-13,25-26H |
| InChIKey | FNUUGDZTSXLIRW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|