C17H10N2O3 — CID 135059428
2-[2-(3-nitrophenyl)ethynyl]-5-phenyl-1,3-oxazole (PubChem CID 135059428) has the molecular formula C17H10N2O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is 2-[2-(3-nitrophenyl)ethynyl]-5-phenyl-1,3-oxazole.
| Compound Name | 2-[2-(3-nitrophenyl)ethynyl]-5-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 135059428 |
| Molecular Formula | C17H10N2O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 2-[2-(3-nitrophenyl)ethynyl]-5-phenyl-1,3-oxazole |
| SMILES | O=[N+]([O-])c1cccc(C#Cc2ncc(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C17H10N2O3/c20-19(21)15-8-4-5-13(11-15)9-10-17-18-12-16(22-17)14-6-2-1-3-7-14/h1-8,11-12H |
| InChIKey | ZQOSACVZMPRORQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|