C12H13N3O3 — CID 65178544
3-[5-(3-nitrophenyl)-1,3-oxazol-2-yl]propan-1-amine (PubChem CID 65178544) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 3-[5-(3-nitrophenyl)-1,3-oxazol-2-yl]propan-1-amine.
| Compound Name | 3-[5-(3-nitrophenyl)-1,3-oxazol-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 65178544 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 3-[5-(3-nitrophenyl)-1,3-oxazol-2-yl]propan-1-amine |
| SMILES | NCCCc1ncc(-c2cccc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C12H13N3O3/c13-6-2-5-12-14-8-11(18-12)9-3-1-4-10(7-9)15(16)17/h1,3-4,7-8H,2,5-6,13H2 |
| InChIKey | SXPKQXMXTXPQMW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 95.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|