C18H26Cl2N4O3 — CID 120776131
3,3-dimethyl-1-[2-[5-(3-nitrophenyl)-1,3-oxazol-2-yl]ethyl]piperidin-4-amine;dihydrochloride (PubChem CID 120776131) has the molecular formula C18H26Cl2N4O3 and a molecular weight of 417.34 g/mol. Its IUPAC name is 3,3-dimethyl-1-[2-[5-(3-nitrophenyl)-1,3-oxazol-2-yl]ethyl]piperidin-4-amine;dihydrochloride.
| Compound Name | 3,3-dimethyl-1-[2-[5-(3-nitrophenyl)-1,3-oxazol-2-yl]ethyl]piperidin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 120776131 |
| Molecular Formula | C18H26Cl2N4O3 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 3,3-dimethyl-1-[2-[5-(3-nitrophenyl)-1,3-oxazol-2-yl]ethyl]piperidin-4-amine;dihydrochloride |
| SMILES | CC1(C)CN(CCc2ncc(-c3cccc([N+](=O)[O-])c3)o2)CCC1N.Cl.Cl |
| InChI | InChI=1S/C18H24N4O3.2ClH/c1-18(2)12-21(8-6-16(18)19)9-7-17-20-11-15(25-17)13-4-3-5-14(10-13)22(23)24;;/h3-5,10-11,16H,6-9,12,19H2,1-2H3;2*1H |
| InChIKey | XQIIDIDRHHQYFX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 98.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|