C20H21N3O3S — CID 86953420
2-[2-[2-(5-methylthiophen-2-yl)pyrrolidin-1-yl]ethyl]-5-(3-nitrophenyl)-1,3-oxazole (PubChem CID 86953420) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is 2-[2-[2-(5-methylthiophen-2-yl)pyrrolidin-1-yl]ethyl]-5-(3-nitrophenyl)-1,3-oxazole.
| Compound Name | 2-[2-[2-(5-methylthiophen-2-yl)pyrrolidin-1-yl]ethyl]-5-(3-nitrophenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 86953420 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 2-[2-[2-(5-methylthiophen-2-yl)pyrrolidin-1-yl]ethyl]-5-(3-nitrophenyl)-1,3-oxazole |
| SMILES | Cc1ccc(C2CCCN2CCc2ncc(-c3cccc([N+](=O)[O-])c3)o2)s1 |
| InChI | InChI=1S/C20H21N3O3S/c1-14-7-8-19(27-14)17-6-3-10-22(17)11-9-20-21-13-18(26-20)15-4-2-5-16(12-15)23(24)25/h2,4-5,7-8,12-13,17H,3,6,9-11H2,1H3 |
| InChIKey | TVEOEUJEDTWWKL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 72.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|