About 7-nitro-3-[(5-phenyl-1,3-oxazol-2-yl)methyl]quinazolin-4-one
7-nitro-3-[(5-phenyl-1,3-oxazol-2-yl)methyl]quinazolin-4-one (PubChem CID 78789148) has the molecular formula C18H12N4O4
and a molecular weight of 348.32 g/mol. Its IUPAC name is 7-nitro-3-[(5-phenyl-1,3-oxazol-2-yl)methyl]quinazolin-4-one.
Molecular Properties
| Compound Name | 7-nitro-3-[(5-phenyl-1,3-oxazol-2-yl)methyl]quinazolin-4-one |
| PubChem CID | 78789148 |
| Molecular Formula | C18H12N4O4 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 7-nitro-3-[(5-phenyl-1,3-oxazol-2-yl)methyl]quinazolin-4-one |
| SMILES | O=c1c2ccc([N+](=O)[O-])cc2ncn1Cc1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C18H12N4O4/c23-18-14-7-6-13(22(24)25)8-15(14)20-11-21(18)10-17-19-9-16(26-17)12-4-2-1-3-5-12/h1-9,11H,10H2 |
| InChIKey | QELJQBYXTMEVMI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 104.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-nitro-3-[(5-phenyl-1,3-oxazol-2-yl)methyl]quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-nitro-3-[(5-phenyl-1,3-oxazol-2-yl)methyl]quinazolin-4-one?
The IUPAC name of 7-nitro-3-[(5-phenyl-1,3-oxazol-2-yl)methyl]quinazolin-4-one (CID 78789148) is 7-nitro-3-[(5-phenyl-1,3-oxazol-2-yl)methyl]quinazolin-4-one.
What is the SMILES notation for 7-nitro-3-[(5-phenyl-1,3-oxazol-2-yl)methyl]quinazolin-4-one?
The canonical SMILES for 7-nitro-3-[(5-phenyl-1,3-oxazol-2-yl)methyl]quinazolin-4-one is O=c1c2ccc([N+](=O)[O-])cc2ncn1Cc1ncc(-c2ccccc2)o1.
What is the InChIKey of 7-nitro-3-[(5-phenyl-1,3-oxazol-2-yl)methyl]quinazolin-4-one?
The InChIKey is QELJQBYXTMEVMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N4O4/c23-18-14-7-6-13(22(24)25)8-15(14)20-11-21(18)10-17-19-9-16(26-17)12-4-2-1-3-5-12/h1-9,11H,10H2.
What are the key properties of 7-nitro-3-[(5-phenyl-1,3-oxazol-2-yl)methyl]quinazolin-4-one?
7-nitro-3-[(5-phenyl-1,3-oxazol-2-yl)methyl]quinazolin-4-one has a molecular weight of 348.32 g/mol, XLogP of 3.01, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-nitro-3-[(5-phenyl-1,3-oxazol-2-yl)methyl]quinazolin-4-one is sourced from PubChem (CID 78789148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).