C20H15N3O6 — CID 78788520
ethyl 3-[(7-nitro-4-oxoquinazolin-3-yl)methyl]-1-benzofuran-2-carboxylate (PubChem CID 78788520) has the molecular formula C20H15N3O6 and a molecular weight of 393.36 g/mol. Its IUPAC name is ethyl 3-[(7-nitro-4-oxoquinazolin-3-yl)methyl]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 3-[(7-nitro-4-oxoquinazolin-3-yl)methyl]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 78788520 |
| Molecular Formula | C20H15N3O6 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | ethyl 3-[(7-nitro-4-oxoquinazolin-3-yl)methyl]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccccc2c1Cn1cnc2cc([N+](=O)[O-])ccc2c1=O |
| InChI | InChI=1S/C20H15N3O6/c1-2-28-20(25)18-15(13-5-3-4-6-17(13)29-18)10-22-11-21-16-9-12(23(26)27)7-8-14(16)19(22)24/h3-9,11H,2,10H2,1H3 |
| InChIKey | VGWYKUNUUOKBLS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 117.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|