C19H16N4O4 — CID 3892710
3-[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl]-7-nitroquinazolin-4-one (PubChem CID 3892710) has the molecular formula C19H16N4O4 and a molecular weight of 364.36 g/mol. Its IUPAC name is 3-[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl]-7-nitroquinazolin-4-one.
| Compound Name | 3-[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl]-7-nitroquinazolin-4-one |
|---|---|
| PubChem CID | 3892710 |
| Molecular Formula | C19H16N4O4 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 3-[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl]-7-nitroquinazolin-4-one |
| SMILES | CC1Cc2ccccc2N1C(=O)Cn1cnc2cc([N+](=O)[O-])ccc2c1=O |
| InChI | InChI=1S/C19H16N4O4/c1-12-8-13-4-2-3-5-17(13)22(12)18(24)10-21-11-20-16-9-14(23(26)27)6-7-15(16)19(21)25/h2-7,9,11-12H,8,10H2,1H3 |
| InChIKey | NXTUYASPFNDIJE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|