C23H27N3O3 — CID 101346832
1-(2-methyl-2,3-dihydroindol-1-yl)-2-[4-[(4-nitrophenyl)methyl]piperidin-1-yl]ethanone (PubChem CID 101346832) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 1-(2-methyl-2,3-dihydroindol-1-yl)-2-[4-[(4-nitrophenyl)methyl]piperidin-1-yl]ethanone.
| Compound Name | 1-(2-methyl-2,3-dihydroindol-1-yl)-2-[4-[(4-nitrophenyl)methyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 101346832 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 1-(2-methyl-2,3-dihydroindol-1-yl)-2-[4-[(4-nitrophenyl)methyl]piperidin-1-yl]ethanone |
| SMILES | CC1Cc2ccccc2N1C(=O)CN1CCC(Cc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C23H27N3O3/c1-17-14-20-4-2-3-5-22(20)25(17)23(27)16-24-12-10-19(11-13-24)15-18-6-8-21(9-7-18)26(28)29/h2-9,17,19H,10-16H2,1H3 |
| InChIKey | UVSCBXSIJASGHU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|