C24H26N6O5 — CID 55578336
N-(2-ethylphenyl)-2-[4-[2-(7-nitro-4-oxoquinazolin-3-yl)acetyl]piperazin-1-yl]acetamide (PubChem CID 55578336) has the molecular formula C24H26N6O5 and a molecular weight of 478.51 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[4-[2-(7-nitro-4-oxoquinazolin-3-yl)acetyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2-ethylphenyl)-2-[4-[2-(7-nitro-4-oxoquinazolin-3-yl)acetyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55578336 |
| Molecular Formula | C24H26N6O5 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | N-(2-ethylphenyl)-2-[4-[2-(7-nitro-4-oxoquinazolin-3-yl)acetyl]piperazin-1-yl]acetamide |
| SMILES | CCc1ccccc1NC(=O)CN1CCN(C(=O)Cn2cnc3cc([N+](=O)[O-])ccc3c2=O)CC1 |
| InChI | InChI=1S/C24H26N6O5/c1-2-17-5-3-4-6-20(17)26-22(31)14-27-9-11-28(12-10-27)23(32)15-29-16-25-21-13-18(30(34)35)7-8-19(21)24(29)33/h3-8,13,16H,2,9-12,14-15H2,1H3,(H,26,31) |
| InChIKey | FATXJVAWMCFLQX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 130.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|