C19H16O7 — CID 44610153
[2-(3,4-dihydroxyphenyl)-7-hydroxy-4-oxochromen-5-yl] 2-methylpropanoate (PubChem CID 44610153) has the molecular formula C19H16O7 and a molecular weight of 356.33 g/mol. Its IUPAC name is [2-(3,4-dihydroxyphenyl)-7-hydroxy-4-oxochromen-5-yl] 2-methylpropanoate.
| Compound Name | [2-(3,4-dihydroxyphenyl)-7-hydroxy-4-oxochromen-5-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 44610153 |
| Molecular Formula | C19H16O7 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | [2-(3,4-dihydroxyphenyl)-7-hydroxy-4-oxochromen-5-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)Oc1cc(O)cc2oc(-c3ccc(O)c(O)c3)cc(=O)c12 |
| InChI | InChI=1S/C19H16O7/c1-9(2)19(24)26-17-7-11(20)6-16-18(17)14(23)8-15(25-16)10-3-4-12(21)13(22)5-10/h3-9,20-22H,1-2H3 |
| InChIKey | PQFJRDPDYDMRGJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|