C23H24O9 — CID 19049260
[5-[7-(2,3-dihydroxypropoxy)-5-hydroxy-4-oxochromen-2-yl]-2-methoxyphenyl] 2-methylpropanoate (PubChem CID 19049260) has the molecular formula C23H24O9 and a molecular weight of 444.44 g/mol. Its IUPAC name is [5-[7-(2,3-dihydroxypropoxy)-5-hydroxy-4-oxochromen-2-yl]-2-methoxyphenyl] 2-methylpropanoate.
| Compound Name | [5-[7-(2,3-dihydroxypropoxy)-5-hydroxy-4-oxochromen-2-yl]-2-methoxyphenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 19049260 |
| Molecular Formula | C23H24O9 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | [5-[7-(2,3-dihydroxypropoxy)-5-hydroxy-4-oxochromen-2-yl]-2-methoxyphenyl] 2-methylpropanoate |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)cc(OCC(O)CO)cc3o2)cc1OC(=O)C(C)C |
| InChI | InChI=1S/C23H24O9/c1-12(2)23(28)32-20-6-13(4-5-18(20)29-3)19-9-17(27)22-16(26)7-15(8-21(22)31-19)30-11-14(25)10-24/h4-9,12,14,24-26H,10-11H2,1-3H3 |
| InChIKey | MLNIVWHAPSNYGV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 135.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|